ELX

?

Summary

Name:(2~{E},6~{E},10~{E})-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol
Formula:C20 H34 O
Formal charge:0
Molecular weight:290.483 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.7(2~{E},6~{E},10~{E})-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C20H34O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h9,11,13,15,21H,6-8,10,12,14,16H2,1-5H3/b18-11+,19-13+,20-15+
InChIKeyInChI1.03OJISWRZIEWCUBN-QIRCYJPOSA-N
SMILES_CANONICALCACTVS3.385CC(C)=CCCC(/C)=C/CC\C(C)=C\CC\C(C)=C\CO
SMILESCACTVS3.385CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCO
SMILES_CANONICALOpenEye OEToolkits2.0.7CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CO)/C)/C)/C)C
SMILESOpenEye OEToolkits2.0.7CC(=CCCC(=CCCC(=CCCC(=CCO)C)C)C)C
171916
PDB entries from 2020-12-02