EL

?

Summary

Name:ELLIPTICINE
Formula:C17 H15 N2
Formal charge:1
Molecular weight:247.314 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.045,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium
OpenEye OEToolkits1.5.05,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04c1cccc4c1c2c(c(c3c(c2C)c[nH+]cc3)C)n4
SMILES_CANONICALCACTVS3.341Cc1c2[nH]c3ccccc3c2c(C)c4c[nH+]ccc14
SMILESCACTVS3.341Cc1c2[nH]c3ccccc3c2c(C)c4c[nH+]ccc14
SMILES_CANONICALOpenEye OEToolkits1.5.0Cc1c2cc[nH+]cc2c(c3c1[nH]c4c3cccc4)C
SMILESOpenEye OEToolkits1.5.0Cc1c2cc[nH+]cc2c(c3c1[nH]c4c3cccc4)C
InChIInChI1.03InChI=1S/C17H14N2/c1-10-14-9-18-8-7-12(14)11(2)17-16(10)13-5-3-4-6-15(13)19-17/h3-9,19H,1-2H3/p+1
InChIKeyInChI1.03CTSPAMFJBXKSOY-UHFFFAOYSA-O
169436
PDB entries from 2020-09-30