EJO

?

Summary

Name:7-(diethylamino)chromen-2-one
Formula:C13 H15 N O2
Formal charge:0
Molecular weight:217.264 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.77-(diethylamino)chromen-2-one

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C13H15NO2/c1-3-14(4-2)11-7-5-10-6-8-13(15)16-12(10)9-11/h5-9H,3-4H2,1-2H3
InChIKeyInChI1.03QXAMGWKESXGGNV-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CCN(CC)c1ccc2C=CC(=O)Oc2c1
SMILESCACTVS3.385CCN(CC)c1ccc2C=CC(=O)Oc2c1
SMILES_CANONICALOpenEye OEToolkits2.0.7CCN(CC)c1ccc2c(c1)OC(=O)C=C2
SMILESOpenEye OEToolkits2.0.7CCN(CC)c1ccc2c(c1)OC(=O)C=C2