DPP

?

Summary

Name:DIAMINOPROPANOIC ACID
Formula:C3 H8 N2 O2
Formal charge:0
Molecular weight:104.108 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs12.013-amino-L-alanine
OpenEye OEToolkits1.7.2(2S)-2,3-bis(azanyl)propanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)C(N)CN
InChIInChI1.03InChI=1S/C3H8N2O2/c4-1-2(5)3(6)7/h2H,1,4-5H2,(H,6,7)/t2-/m0/s1
InChIKeyInChI1.03PECYZEOJVXMISF-REOHCLBHSA-N
SMILES_CANONICALCACTVS3.370NC[C@H](N)C(O)=O
SMILESCACTVS3.370NC[CH](N)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.2C([C@@H](C(=O)O)N)N
SMILESOpenEye OEToolkits1.7.2C(C(C(=O)O)N)N
170172
PDB entries from 2020-10-21