CYW

?

Summary

Name:S-[(2R)-2-hydroxypropanoyl]-L-cysteine
Synonyms:lactoylglutathione
Formula:C6 H11 N O4 S
Formal charge:0
Molecular weight:193.221 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs12.01S-[(2R)-2-hydroxypropanoyl]-L-cysteine
OpenEye OEToolkits1.7.0(2R)-2-azanyl-3-[(2R)-2-hydroxypropanoyl]sulfanyl-propanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(SCC(C(=O)O)N)C(O)C
SMILES_CANONICALCACTVS3.370C[C@@H](O)C(=O)SC[C@H](N)C(O)=O
SMILESCACTVS3.370C[CH](O)C(=O)SC[CH](N)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.0C[C@H](C(=O)SC[C@@H](C(=O)O)N)O
SMILESOpenEye OEToolkits1.7.0CC(C(=O)SCC(C(=O)O)N)O
InChIInChI1.03InChI=1S/C6H11NO4S/c1-3(8)6(11)12-2-4(7)5(9)10/h3-4,8H,2,7H2,1H3,(H,9,10)/t3-,4+/m1/s1
InChIKeyInChI1.03SRTPBDVCLYHKFK-DMTCNVIQSA-N