CYS

?

Summary

Name:CYSTEINE
Formula:C3 H7 N O2 S
Formal charge:0
Molecular weight:121.158 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs10.04L-cysteine
OpenEye OEToolkits1.5.0(2R)-2-amino-3-sulfanyl-propanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(N)CS
SMILES_CANONICALCACTVS3.341N[C@@H](CS)C(O)=O
SMILESCACTVS3.341N[CH](CS)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0C([C@@H](C(=O)O)N)S
SMILESOpenEye OEToolkits1.5.0C(C(C(=O)O)N)S
InChIInChI1.03InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1
InChIKeyInChI1.03XUJNEKJLAYXESH-REOHCLBHSA-N