CX5

?

Summary

Name:piperidin-1-yl(quinoxalin-6-yl)methanone
Formula:C14 H15 N3 O
Formal charge:0
Molecular weight:241.288 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01piperidin-1-yl(quinoxalin-6-yl)methanone
OpenEye OEToolkits1.7.6piperidin-1-yl(quinoxalin-6-yl)methanone

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(c2cc1nccnc1cc2)N3CCCCC3
InChIInChI1.03InChI=1S/C14H15N3O/c18-14(17-8-2-1-3-9-17)11-4-5-12-13(10-11)16-7-6-15-12/h4-7,10H,1-3,8-9H2
InChIKeyInChI1.03ANDGGVOPIJEHOF-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370O=C(N1CCCCC1)c2ccc3nccnc3c2
SMILESCACTVS3.370O=C(N1CCCCC1)c2ccc3nccnc3c2
SMILES_CANONICALOpenEye OEToolkits1.7.6c1cc2c(cc1C(=O)N3CCCCC3)nccn2
SMILESOpenEye OEToolkits1.7.6c1cc2c(cc1C(=O)N3CCCCC3)nccn2