CVO

?

Summary

Name:piperidin-4-ylmethyl 4-(aminomethyl)-4-fluoranyl-piperidine-1-carboxylate
Formula:C13 H24 F N3 O2
Formal charge:0
Molecular weight:273.347 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.7piperidin-4-ylmethyl 4-(aminomethyl)-4-fluoranyl-piperidine-1-carboxylate

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C13H24FN3O2/c14-13(10-15)3-7-17(8-4-13)12(18)19-9-11-1-5-16-6-2-11/h11,16H,1-10,15H2
InChIKeyInChI1.03DOWIQGRBTWGHLC-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385NCC1(F)CCN(CC1)C(=O)OCC2CCNCC2
SMILESCACTVS3.385NCC1(F)CCN(CC1)C(=O)OCC2CCNCC2
SMILES_CANONICALOpenEye OEToolkits2.0.7C1CNCCC1COC(=O)N2CCC(CC2)(CN)F
SMILESOpenEye OEToolkits2.0.7C1CNCCC1COC(=O)N2CCC(CC2)(CN)F