CLK

?

Summary

Name:ALPHA-N-DICHLOROACETYL-P-AMINOPHENYLSERINOL
Formula:C11 H14 Cl2 N2 O3
Formal charge:0
Molecular weight:293.146 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04N-[(1R,2R)-2-(4-aminophenyl)-2-hydroxy-1-(hydroxymethyl)ethyl]-2,2-dichloroacetamide
OpenEye OEToolkits1.5.0N-[(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxy-propan-2-yl]-2,2-dichloro-ethanamide

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04ClC(Cl)C(=O)NC(C(O)c1ccc(N)cc1)CO
SMILES_CANONICALCACTVS3.341Nc1ccc(cc1)[C@@H](O)[C@@H](CO)NC(=O)C(Cl)Cl
SMILESCACTVS3.341Nc1ccc(cc1)[CH](O)[CH](CO)NC(=O)C(Cl)Cl
SMILES_CANONICALOpenEye OEToolkits1.5.0c1cc(ccc1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)N
SMILESOpenEye OEToolkits1.5.0c1cc(ccc1C(C(CO)NC(=O)C(Cl)Cl)O)N
InChIInChI1.03InChI=1S/C11H14Cl2N2O3/c12-10(13)11(18)15-8(5-16)9(17)6-1-3-7(14)4-2-6/h1-4,8-10,16-17H,5,14H2,(H,15,18)/t8-,9-/m1/s1
InChIKeyInChI1.03BFLNGKUCFYKCFZ-RKDXNWHRSA-N