CLH

?

Summary

Name:2-AMINO-6-[2-(2-OXO-ACETYLAMINO)-ACETYLAMINO]-HEXANOIC ACID
Formula:C10 H17 N3 O5
Formal charge:0
Molecular weight:259.259 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs10.04N~6~-[N-(oxoacetyl)glycyl]-L-lysine
OpenEye OEToolkits1.5.0(2S)-2-amino-6-[2-(oxaldehydoylamino)ethanoylamino]hexanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=CC(=O)NCC(=O)NCCCCC(N)C(=O)O
SMILES_CANONICALCACTVS3.341N[C@@H](CCCCNC(=O)CNC(=O)C=O)C(O)=O
SMILESCACTVS3.341N[CH](CCCCNC(=O)CNC(=O)C=O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0C(CCNC(=O)CNC(=O)C=O)C[C@@H](C(=O)O)N
SMILESOpenEye OEToolkits1.5.0C(CCNC(=O)CNC(=O)C=O)CC(C(=O)O)N
InChIInChI1.03InChI=1S/C10H17N3O5/c11-7(10(17)18)3-1-2-4-12-8(15)5-13-9(16)6-14/h6-7H,1-5,11H2,(H,12,15)(H,13,16)(H,17,18)/t7-/m0/s1
InChIKeyInChI1.03JGTOTYLLHQQHPV-ZETCQYMHSA-N
167132
PDB entries from 2020-07-29