CK2

?

Summary

Name:4-(2,4-DIMETHYL-1,3-THIAZOL-5-YL)PYRIMIDIN-2-AMINE
Synonyms:4-(2,4-DIMETHYL-THIAZOL-5-YL)-PYRIMIDIN-2-YLAMINE
Formula:C9 H10 N4 S
Formal charge:0
Molecular weight:206.267 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.044-(2,4-dimethyl-1,3-thiazol-5-yl)pyrimidin-2-amine
OpenEye OEToolkits1.5.04-(2,4-dimethyl-1,3-thiazol-5-yl)pyrimidin-2-amine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04n2c(c1sc(nc1C)C)ccnc2N
SMILES_CANONICALCACTVS3.341Cc1sc(c(C)n1)c2ccnc(N)n2
SMILESCACTVS3.341Cc1sc(c(C)n1)c2ccnc(N)n2
SMILES_CANONICALOpenEye OEToolkits1.5.0Cc1c(sc(n1)C)c2ccnc(n2)N
SMILESOpenEye OEToolkits1.5.0Cc1c(sc(n1)C)c2ccnc(n2)N
InChIInChI1.03InChI=1S/C9H10N4S/c1-5-8(14-6(2)12-5)7-3-4-11-9(10)13-7/h3-4H,1-2H3,(H2,10,11,13)
InChIKeyInChI1.03CTFDMGIBHFQWKB-UHFFFAOYSA-N
167518
PDB entries from 2020-08-12