CJ8

?

Summary

Name:(2~{R},3~{R})-2,3-bis(oxidanyl)-~{N},~{N}'-dipropyl-butanediamide
Formula:C10 H20 N2 O4
Formal charge:0
Molecular weight:232.277 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.6(2~{R},3~{R})-2,3-bis(oxidanyl)-~{N},~{N}'-dipropyl-butanediamide

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C10H20N2O4/c1-3-5-11-9(15)7(13)8(14)10(16)12-6-4-2/h7-8,13-14H,3-6H2,1-2H3,(H,11,15)(H,12,16)/t7-,8-/m1/s1
InChIKeyInChI1.03GCNAACQQQUCOMO-HTQZYQBOSA-N
SMILES_CANONICALCACTVS3.385CCCNC(=O)[C@H](O)[C@@H](O)C(=O)NCCC
SMILESCACTVS3.385CCCNC(=O)[CH](O)[CH](O)C(=O)NCCC
SMILES_CANONICALOpenEye OEToolkits2.0.6CCCNC(=O)[C@@H]([C@H](C(=O)NCCC)O)O
SMILESOpenEye OEToolkits2.0.6CCCNC(=O)C(C(C(=O)NCCC)O)O