CGN

?

Summary

Name:5-OXO-PYRROLIDINE-2-CARBALDEHYDE
Formula:C5 H7 N O2
Formal charge:0
Molecular weight:113.115 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(2S)-5-oxopyrrolidine-2-carbaldehyde
OpenEye OEToolkits1.5.0(2S)-5-oxopyrrolidine-2-carbaldehyde

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=CC1NC(=O)CC1
SMILES_CANONICALCACTVS3.341O=C[C@@H]1CCC(=O)N1
SMILESCACTVS3.341O=C[CH]1CCC(=O)N1
SMILES_CANONICALOpenEye OEToolkits1.5.0C1CC(=O)N[C@@H]1C=O
SMILESOpenEye OEToolkits1.5.0C1CC(=O)NC1C=O
InChIInChI1.03InChI=1S/C5H7NO2/c7-3-4-1-2-5(8)6-4/h3-4H,1-2H2,(H,6,8)/t4-/m0/s1
InChIKeyInChI1.03XBGYMVTXOUKXLG-BYPYZUCNSA-N