CFT

?

Summary

Name:TRIFLUOROMETHANE
Formula:C H F3
Formal charge:0
Molecular weight:70.014 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04trifluoromethane
OpenEye OEToolkits1.5.0trifluoromethane

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04FC(F)F
SMILES_CANONICALCACTVS3.341FC(F)F
SMILESCACTVS3.341FC(F)F
SMILES_CANONICALOpenEye OEToolkits1.5.0C(F)(F)F
SMILESOpenEye OEToolkits1.5.0C(F)(F)F
InChIInChI1.03InChI=1S/CHF3/c2-1(3)4/h1H
InChIKeyInChI1.03XPDWGBQVDMORPB-UHFFFAOYSA-N
170383
PDB entries from 2020-10-28