CEO

?

Summary

Name:5-METHYLENE-2-[2-OXO-1-(2-THIOPHEN-2-YL-ACETYLAMINO)-ETHYL]-5,6-DIHYDRO-2H-[1,3]THIAZINE-4-CARBOXYLIC ACID
Synonyms:HYDROLYZED CEPHALOTHIN
Formula:C14 H14 N2 O4 S2
Formal charge:0
Molecular weight:338.402 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(2R)-5-methylidene-2-{(1R)-2-oxo-1-[(thiophen-2-ylacetyl)amino]ethyl}-5,6-dihydro-2H-1,3-thiazine-4-carboxylic acid
OpenEye OEToolkits1.5.0(2R)-5-methylidene-2-[(1R)-2-oxo-1-(2-thiophen-2-ylethanoylamino)ethyl]-2H-1,3-thiazine-4-carboxylic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=CC(NC(=O)Cc1sccc1)C2N=C(\C(=C)CS2)C(=O)O
SMILES_CANONICALCACTVS3.341OC(=O)C1=N[C@H](SCC1=C)[C@H](NC(=O)Cc2sccc2)C=O
SMILESCACTVS3.341OC(=O)C1=N[CH](SCC1=C)[CH](NC(=O)Cc2sccc2)C=O
SMILES_CANONICALOpenEye OEToolkits1.5.0C=C1CS[C@@H](N=C1C(=O)O)[C@@H](C=O)NC(=O)Cc2cccs2
SMILESOpenEye OEToolkits1.5.0C=C1CSC(N=C1C(=O)O)C(C=O)NC(=O)Cc2cccs2
InChIInChI1.03InChI=1S/C14H14N2O4S2/c1-8-7-22-13(16-12(8)14(19)20)10(6-17)15-11(18)5-9-3-2-4-21-9/h2-4,6,10,13H,1,5,7H2,(H,15,18)(H,19,20)/t10-,13-/m1/s1
InChIKeyInChI1.03FYGLCWWPHIWVKN-ZWNOBZJWSA-N
167518
PDB entries from 2020-08-12