CDT

?

Summary

Name:4-METHYLSULFANYL-2-UREIDO-BUTYRIC ACID
Synonyms:N-CARBAMYL-D-METHIONINE
Formula:C6 H12 N2 O3 S
Formal charge:0
Molecular weight:192.236 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04N-carbamoyl-D-methionine
OpenEye OEToolkits1.5.0(2R)-2-(aminocarbonylamino)-4-methylsulfanyl-butanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(NC(C(=O)O)CCSC)N
SMILES_CANONICALCACTVS3.341CSCC[C@@H](NC(N)=O)C(O)=O
SMILESCACTVS3.341CSCC[CH](NC(N)=O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0CSCC[C@H](C(=O)O)NC(=O)N
SMILESOpenEye OEToolkits1.5.0CSCCC(C(=O)O)NC(=O)N
InChIInChI1.03InChI=1S/C6H12N2O3S/c1-12-3-2-4(5(9)10)8-6(7)11/h4H,2-3H2,1H3,(H,9,10)(H3,7,8,11)/t4-/m1/s1
InChIKeyInChI1.03DEWDMTSMCKXBNP-SCSAIBSYSA-N
167518
PDB entries from 2020-08-12