C9N

?

Summary

Name:2-[[(2~{S})-2-azanylpropyl]-methyl-amino]ethanol
Formula:C6 H16 N2 O
Formal charge:0
Molecular weight:132.204 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.62-[[(2~{S})-2-azanylpropyl]-methyl-amino]ethanol

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C6H16N2O/c1-6(7)5-8(2)3-4-9/h6,9H,3-5,7H2,1-2H3/t6-/m0/s1
InChIKeyInChI1.03RVKPNBCSECRBTR-LURJTMIESA-N
SMILES_CANONICALCACTVS3.385C[C@H](N)CN(C)CCO
SMILESCACTVS3.385C[CH](N)CN(C)CCO
SMILES_CANONICALOpenEye OEToolkits2.0.6C[C@@H](CN(C)CCO)N
SMILESOpenEye OEToolkits2.0.6CC(CN(C)CCO)N
167132
PDB entries from 2020-07-29