C2M

?

Summary

Name:5-(3,4-DICHLOROPHENYL)-6-METHYLPYRIMIDINE-2,4-DIAMINE
Synonyms:METOPRINE
METHODICHLOROPHEN
Formula:C11 H10 Cl2 N4
Formal charge:0
Molecular weight:269.13 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.045-(3,4-dichlorophenyl)-6-methylpyrimidine-2,4-diamine
OpenEye OEToolkits1.5.05-(3,4-dichlorophenyl)-6-methyl-pyrimidine-2,4-diamine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04Clc2ccc(c1c(nc(nc1C)N)N)cc2Cl
SMILES_CANONICALCACTVS3.341Cc1nc(N)nc(N)c1c2ccc(Cl)c(Cl)c2
SMILESCACTVS3.341Cc1nc(N)nc(N)c1c2ccc(Cl)c(Cl)c2
SMILES_CANONICALOpenEye OEToolkits1.5.0Cc1c(c(nc(n1)N)N)c2ccc(c(c2)Cl)Cl
SMILESOpenEye OEToolkits1.5.0Cc1c(c(nc(n1)N)N)c2ccc(c(c2)Cl)Cl
InChIInChI1.03InChI=1S/C11H10Cl2N4/c1-5-9(10(14)17-11(15)16-5)6-2-3-7(12)8(13)4-6/h2-4H,1H3,(H4,14,15,16,17)
InChIKeyInChI1.03VQJHOPSWBGJHQS-UHFFFAOYSA-N
167518
PDB entries from 2020-08-12