BGC

?

Summary

Name:BETA-D-GLUCOSE
Formula:C6 H12 O6
Formal charge:0
Molecular weight:180.156 Da
Component type:SACCHARIDE

Chemical Identifiers

ProgramVersionName
ACDLabs12.01beta-D-glucopyranose
OpenEye OEToolkits1.7.6(2R,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01OC1C(O)C(OC(O)C1O)CO
InChIInChI1.03InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6-/m1/s1
InChIKeyInChI1.03WQZGKKKJIJFFOK-VFUOTHLCSA-N
SMILES_CANONICALCACTVS3.370OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O
SMILESCACTVS3.370OC[CH]1O[CH](O)[CH](O)[CH](O)[CH]1O
SMILES_CANONICALOpenEye OEToolkits1.7.6C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)O)O)O)O
SMILESOpenEye OEToolkits1.7.6C(C1C(C(C(C(O1)O)O)O)O)O