ACY

?

Summary

Name:ACETIC ACID
Formula:C2 H4 O2
Formal charge:0
Molecular weight:60.052 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs11.02acetic acid
OpenEye OEToolkits1.6.1ethanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs11.02O=C(O)C
SMILES_CANONICALCACTVS3.352CC(O)=O
SMILESCACTVS3.352CC(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.0CC(=O)O
SMILESOpenEye OEToolkits1.7.0CC(=O)O
InChIInChI1.03InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
InChIKeyInChI1.03QTBSBXVTEAMEQO-UHFFFAOYSA-N