ACD

?

Summary

Name:ARACHIDONIC ACID
Formula:C20 H32 O2
Formal charge:0
Molecular weight:304.467 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid
OpenEye OEToolkits1.5.0(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC
SMILES_CANONICALCACTVS3.341CCCCC/C=C\C\C=C/C/C=C\C\C=C/CCCC(O)=O
SMILESCACTVS3.341CCCCCC=CCC=CCC=CCC=CCCCC(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)O
SMILESOpenEye OEToolkits1.5.0CCCCCC=CCC=CCC=CCC=CCCCC(=O)O
InChIInChI1.03InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/b7-6-,10-9-,13-12-,16-15-
InChIKeyInChI1.03YZXBAPSDXZZRGB-DOFZRALJSA-N