AA

?

Summary

Name:9-AMINOACRIDINE
Formula:C13 H11 N2
Formal charge:1
Molecular weight:195.24 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits1.5.0acridin-10-ium-9-amine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESCACTVS2.87Nc1c2ccccc2[nH+]c3ccccc13
SMILES_CANONICALCACTVS2.87Nc1c2ccccc2[nH+]c3ccccc13
SMILES_CANONICALOpenEye OEToolkits1.5.0c1ccc2c(c1)c(c3ccccc3[nH+]2)N
SMILESOpenEye OEToolkits1.5.0c1ccc2c(c1)c(c3ccccc3[nH+]2)N
InChIInChI1.03InChI=1S/C13H10N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H2,14,15)/p+1
InChIKeyInChI1.03XJGFWWJLMVZSIG-UHFFFAOYSA-O
167518
PDB entries from 2020-08-12