A0R

?

Summary

Name:2',4'-dihydroxy-2-methoxychalcone
Formula:C16 H14 O4
Formal charge:0
Molecular weight:270.28 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.6(~{E})-1-[2,4-bis(oxidanyl)phenyl]-3-(2-methoxyphenyl)prop-2-en-1-one

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C16H14O4/c1-20-16-5-3-2-4-11(16)6-9-14(18)13-8-7-12(17)10-15(13)19/h2-10,17,19H,1H3/b9-6+
InChIKeyInChI1.03ODLVGCCGMXGMGZ-RMKNXTFCSA-N
SMILES_CANONICALCACTVS3.385COc1ccccc1\C=C\C(=O)c2ccc(O)cc2O
SMILESCACTVS3.385COc1ccccc1C=CC(=O)c2ccc(O)cc2O
SMILES_CANONICALOpenEye OEToolkits2.0.6COc1ccccc1/C=C/C(=O)c2ccc(cc2O)O
SMILESOpenEye OEToolkits2.0.6COc1ccccc1C=CC(=O)c2ccc(cc2O)O