9ZE

?

Summary

Name:1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone
Formula:C10 H10 O3
Formal charge:0
Molecular weight:178.185 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.011-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone
OpenEye OEToolkits1.7.61-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(c1ccc2OCCOc2c1)C
InChIInChI1.03InChI=1S/C10H10O3/c1-7(11)8-2-3-9-10(6-8)13-5-4-12-9/h2-3,6H,4-5H2,1H3
InChIKeyInChI1.03HGVWMTAIIYNQSI-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CC(=O)c1ccc2OCCOc2c1
SMILESCACTVS3.385CC(=O)c1ccc2OCCOc2c1
SMILES_CANONICALOpenEye OEToolkits1.7.6CC(=O)c1ccc2c(c1)OCCO2
SMILESOpenEye OEToolkits1.7.6CC(=O)c1ccc2c(c1)OCCO2