9U3

?

Summary

Name:N,N,N',N'-tetramethylethane-1,2-diamine
Formula:C6 H16 N2
Formal charge:0
Molecular weight:116.205 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01N~1~,N~1~,N~2~,N~2~-tetramethylethane-1,2-diamine
OpenEye OEToolkits2.0.6~{N},~{N},~{N}',~{N}'-tetramethylethane-1,2-diamine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01CN(C)CCN(C)C
InChIInChI1.03InChI=1S/C6H16N2/c1-7(2)5-6-8(3)4/h5-6H2,1-4H3
InChIKeyInChI1.03KWYHDKDOAIKMQN-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CN(C)CCN(C)C
SMILESCACTVS3.385CN(C)CCN(C)C
SMILES_CANONICALOpenEye OEToolkits2.0.6CN(C)CCN(C)C
SMILESOpenEye OEToolkits2.0.6CN(C)CCN(C)C