9TZ

?

Summary

Name:5-fluoranyl-2-methyl-benzoic acid
Formula:C8 H7 F O2
Formal charge:0
Molecular weight:154.138 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.65-fluoranyl-2-methyl-benzoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C8H7FO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H,10,11)
InChIKeyInChI1.03JVBLXLBINTYFPR-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385Cc1ccc(F)cc1C(O)=O
SMILESCACTVS3.385Cc1ccc(F)cc1C(O)=O
SMILES_CANONICALOpenEye OEToolkits2.0.6Cc1ccc(cc1C(=O)O)F
SMILESOpenEye OEToolkits2.0.6Cc1ccc(cc1C(=O)O)F