9TW

?

Summary

Name:3-chloranyl-4-fluoranyl-benzamide
Formula:C7 H5 Cl F N O
Formal charge:0
Molecular weight:173.572 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.63-chloranyl-4-fluoranyl-benzamide

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C7H5ClFNO/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11)
InChIKeyInChI1.03AEYMQEMBMKCNEG-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385NC(=O)c1ccc(F)c(Cl)c1
SMILESCACTVS3.385NC(=O)c1ccc(F)c(Cl)c1
SMILES_CANONICALOpenEye OEToolkits2.0.6c1cc(c(cc1C(=O)N)Cl)F
SMILESOpenEye OEToolkits2.0.6c1cc(c(cc1C(=O)N)Cl)F