9MK

?

Summary

Name:(4-fluoranyl-3-oxidanyl-phenyl)-(6-methylquinolin-2-yl)methanone
Formula:C17 H12 F N O2
Formal charge:0
Molecular weight:281.281 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.6(4-fluoranyl-3-oxidanyl-phenyl)-(6-methylquinolin-2-yl)methanone

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C17H12FNO2/c1-10-2-6-14-11(8-10)4-7-15(19-14)17(21)12-3-5-13(18)16(20)9-12/h2-9,20H,1H3
InChIKeyInChI1.03DIBIPWTWYDLKIZ-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385Cc1ccc2nc(ccc2c1)C(=O)c3ccc(F)c(O)c3
SMILESCACTVS3.385Cc1ccc2nc(ccc2c1)C(=O)c3ccc(F)c(O)c3
SMILES_CANONICALOpenEye OEToolkits2.0.6Cc1ccc2c(c1)ccc(n2)C(=O)c3ccc(c(c3)O)F
SMILESOpenEye OEToolkits2.0.6Cc1ccc2c(c1)ccc(n2)C(=O)c3ccc(c(c3)O)F