9MJ

?

Summary

Name:5-amino-3-(furan-2-yl)-1H-1,2,4-triazole-1-carboxamide
Formula:C7 H7 N5 O2
Formal charge:0
Molecular weight:193.163 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.015-amino-3-(furan-2-yl)-1H-1,2,4-triazole-1-carboxamide
OpenEye OEToolkits1.7.65-azanyl-3-(furan-2-yl)-1,2,4-triazole-1-carboxamide

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(n1nc(nc1N)c2occc2)N
InChIInChI1.03InChI=1S/C7H7N5O2/c8-6-10-5(4-2-1-3-14-4)11-12(6)7(9)13/h1-3H,(H2,9,13)(H2,8,10,11)
InChIKeyInChI1.03NBDYCQJTOKDLCM-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385NC(=O)n1nc(nc1N)c2occc2
SMILESCACTVS3.385NC(=O)n1nc(nc1N)c2occc2
SMILES_CANONICALOpenEye OEToolkits1.7.6c1cc(oc1)c2nc(n(n2)C(=O)N)N
SMILESOpenEye OEToolkits1.7.6c1cc(oc1)c2nc(n(n2)C(=O)N)N