9EX

?

Summary

Name:(2S)-2-methyl-3-sulfanyl-propan-1-ol
Formula:C4 H10 O S
Formal charge:0
Molecular weight:106.187 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.6(2~{S})-2-methyl-3-sulfanyl-propan-1-ol

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C4H10OS/c1-4(2-5)3-6/h4-6H,2-3H2,1H3/t4-/m0/s1
InChIKeyInChI1.03FCIVYWQHILCTLI-BYPYZUCNSA-N
SMILES_CANONICALCACTVS3.385C[C@@H](CO)CS
SMILESCACTVS3.385C[CH](CO)CS
SMILES_CANONICALOpenEye OEToolkits2.0.6C[C@@H](CO)CS
SMILESOpenEye OEToolkits2.0.6CC(CO)CS
170172
PDB entries from 2020-10-21