9E7

?

Summary

Name:N~6~-(sulfanylmethyl)-L-lysine
Formula:C7 H16 N2 O2 S
Formal charge:0
Molecular weight:192.279 Da
Component type:L-peptide linking

Chemical Identifiers

ProgramVersionName
ACDLabs12.01N~6~-(sulfanylmethyl)-L-lysine
OpenEye OEToolkits2.0.6(2~{S})-2-azanyl-6-(sulfanylmethylamino)hexanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01C(O)(C(N)CCCCNCS)=O
InChIInChI1.03InChI=1S/C7H16N2O2S/c8-6(7(10)11)3-1-2-4-9-5-12/h6,9,12H,1-5,8H2,(H,10,11)/t6-/m0/s1
InChIKeyInChI1.03IEEWMGZMRLQVDH-LURJTMIESA-N
SMILES_CANONICALCACTVS3.385N[C@@H](CCCCNCS)C(O)=O
SMILESCACTVS3.385N[CH](CCCCNCS)C(O)=O
SMILES_CANONICALOpenEye OEToolkits2.0.6C(CCNCS)C[C@@H](C(=O)O)N
SMILESOpenEye OEToolkits2.0.6C(CCNCS)CC(C(=O)O)N