5NA

?

Summary

Name:2-hydroxy-5-methyl naphthoic acid
Synonyms:2-hydroxy-5-methylnaphthalene-1-carboxylic acid
Formula:C12 H10 O3
Formal charge:0
Molecular weight:202.206 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs11.022-hydroxy-5-methylnaphthalene-1-carboxylic acid
OpenEye OEToolkits1.6.12-hydroxy-5-methyl-naphthalene-1-carboxylic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs11.02O=C(O)c1c2c(ccc1O)c(ccc2)C
SMILES_CANONICALCACTVS3.352Cc1cccc2c1ccc(O)c2C(O)=O
SMILESCACTVS3.352Cc1cccc2c1ccc(O)c2C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.0Cc1cccc2c1ccc(c2C(=O)O)O
SMILESOpenEye OEToolkits1.7.0Cc1cccc2c1ccc(c2C(=O)O)O
InChIInChI1.03InChI=1S/C12H10O3/c1-7-3-2-4-9-8(7)5-6-10(13)11(9)12(14)15/h2-6,13H,1H3,(H,14,15)
InChIKeyInChI1.03KKMAZNUSFFWQQY-UHFFFAOYSA-N
170383
PDB entries from 2020-10-28