27M

?

Summary

Name:bis(2,4-dihydroxyphenyl)methanone
Formula:C13 H10 O5
Formal charge:0
Molecular weight:246.215 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01bis(2,4-dihydroxyphenyl)methanone
OpenEye OEToolkits1.7.6bis[2,4-bis(oxidanyl)phenyl]methanone

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(c1ccc(O)cc1O)c2ccc(O)cc2O
InChIInChI1.03InChI=1S/C13H10O5/c14-7-1-3-9(11(16)5-7)13(18)10-4-2-8(15)6-12(10)17/h1-6,14-17H
InChIKeyInChI1.03WXNRYSGJLQFHBR-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385Oc1ccc(c(O)c1)C(=O)c2ccc(O)cc2O
SMILESCACTVS3.385Oc1ccc(c(O)c1)C(=O)c2ccc(O)cc2O
SMILES_CANONICALOpenEye OEToolkits1.7.6c1cc(c(cc1O)O)C(=O)c2ccc(cc2O)O
SMILESOpenEye OEToolkits1.7.6c1cc(c(cc1O)O)C(=O)c2ccc(cc2O)O
167518
PDB entries from 2020-08-12