231

?

Summary

Name:4-PHENYL-1H-IMIDAZOLE
Formula:C9 H8 N2
Formal charge:0
Molecular weight:144.173 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.044-phenyl-1H-imidazole
OpenEye OEToolkits1.5.04-phenyl-1H-imidazole

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04n2c(c1ccccc1)cnc2
SMILES_CANONICALCACTVS3.341[nH]1cnc(c1)c2ccccc2
SMILESCACTVS3.341[nH]1cnc(c1)c2ccccc2
SMILES_CANONICALOpenEye OEToolkits1.5.0c1ccc(cc1)c2c[nH]cn2
SMILESOpenEye OEToolkits1.5.0c1ccc(cc1)c2c[nH]cn2
InChIInChI1.03InChI=1S/C9H8N2/c1-2-4-8(5-3-1)9-6-10-7-11-9/h1-7H,(H,10,11)
InChIKeyInChI1.03XHLKOHSAWQPOFO-UHFFFAOYSA-N
167518
PDB entries from 2020-08-12