0XV

?

Summary

Name:(4-hydroxy-3,5-dimethylphenyl)(2-methyl-1-benzofuran-3-yl)methanone
Formula:C18 H16 O3
Formal charge:0
Molecular weight:280.318 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(4-hydroxy-3,5-dimethylphenyl)(2-methyl-1-benzofuran-3-yl)methanone
OpenEye OEToolkits1.7.6(3,5-dimethyl-4-oxidanyl-phenyl)-(2-methyl-1-benzofuran-3-yl)methanone

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(c1c2ccccc2oc1C)c3cc(c(O)c(c3)C)C
InChIInChI1.03InChI=1S/C18H16O3/c1-10-8-13(9-11(2)17(10)19)18(20)16-12(3)21-15-7-5-4-6-14(15)16/h4-9,19H,1-3H3
InChIKeyInChI1.03CIXADHNQIHMLIL-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370Cc1oc2ccccc2c1C(=O)c3cc(C)c(O)c(C)c3
SMILESCACTVS3.370Cc1oc2ccccc2c1C(=O)c3cc(C)c(O)c(C)c3
SMILES_CANONICALOpenEye OEToolkits1.7.6Cc1cc(cc(c1O)C)C(=O)c2c(oc3c2cccc3)C
SMILESOpenEye OEToolkits1.7.6Cc1cc(cc(c1O)C)C(=O)c2c(oc3c2cccc3)C