0OY

?

Summary

Name:(4-hydroxyphenyl)(morpholin-4-yl)methanone
Formula:C11 H13 N O3
Formal charge:0
Molecular weight:207.226 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(4-hydroxyphenyl)(morpholin-4-yl)methanone
OpenEye OEToolkits1.7.6(4-hydroxyphenyl)-morpholin-4-yl-methanone

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(c1ccc(O)cc1)N2CCOCC2
InChIInChI1.03InChI=1S/C11H13NO3/c13-10-3-1-9(2-4-10)11(14)12-5-7-15-8-6-12/h1-4,13H,5-8H2
InChIKeyInChI1.03GJHYHTYGGHFYNN-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370Oc1ccc(cc1)C(=O)N2CCOCC2
SMILESCACTVS3.370Oc1ccc(cc1)C(=O)N2CCOCC2
SMILES_CANONICALOpenEye OEToolkits1.7.6c1cc(ccc1C(=O)N2CCOCC2)O
SMILESOpenEye OEToolkits1.7.6c1cc(ccc1C(=O)N2CCOCC2)O
171916
PDB entries from 2020-12-02