0OO

?

Summary

Name:(3-phenoxyphenyl)methanol
Formula:C13 H12 O2
Formal charge:0
Molecular weight:200.233 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(3-phenoxyphenyl)methanol
OpenEye OEToolkits1.7.6(3-phenoxyphenyl)methanol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O(c1ccccc1)c2cc(ccc2)CO
InChIInChI1.03InChI=1S/C13H12O2/c14-10-11-5-4-8-13(9-11)15-12-6-2-1-3-7-12/h1-9,14H,10H2
InChIKeyInChI1.03KGANAERDZBAECK-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370OCc1cccc(Oc2ccccc2)c1
SMILESCACTVS3.370OCc1cccc(Oc2ccccc2)c1
SMILES_CANONICALOpenEye OEToolkits1.7.6c1ccc(cc1)Oc2cccc(c2)CO
SMILESOpenEye OEToolkits1.7.6c1ccc(cc1)Oc2cccc(c2)CO