0AF

?

Summary

Name:7-hydroxy-L-tryptophan
Formula:C11 H12 N2 O3
Formal charge:0
Molecular weight:220.225 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs10.047-hydroxy-L-tryptophan
OpenEye OEToolkits1.5.0(2S)-2-amino-3-(7-hydroxy-1H-indol-3-yl)propanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(N)Cc2c1cccc(O)c1nc2
SMILES_CANONICALCACTVS3.341N[C@@H](Cc1c[nH]c2c(O)cccc12)C(O)=O
SMILESCACTVS3.341N[CH](Cc1c[nH]c2c(O)cccc12)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0c1cc2c(c[nH]c2c(c1)O)C[C@@H](C(=O)O)N
SMILESOpenEye OEToolkits1.5.0c1cc2c(c[nH]c2c(c1)O)CC(C(=O)O)N
InChIInChI1.03InChI=1S/C11H12N2O3/c12-8(11(15)16)4-6-5-13-10-7(6)2-1-3-9(10)14/h1-3,5,8,13-14H,4,12H2,(H,15,16)/t8-/m0/s1
InChIKeyInChI1.03VQSRKJZICBNQJG-QMMMGPOBSA-N
168889
PDB entries from 2020-09-16