03W

?

Summary

Name:(2R)-propane-1,1,2,3-tetrol
Formula:C3 H8 O4
Formal charge:0
Molecular weight:108.093 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(2R)-propane-1,1,2,3-tetrol
OpenEye OEToolkits1.7.2(2R)-propane-1,1,2,3-tetrol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01OCC(O)C(O)O
InChIInChI1.03InChI=1S/C3H8O4/c4-1-2(5)3(6)7/h2-7H,1H2/t2-/m1/s1
InChIKeyInChI1.03MQVRLONNONYDJP-UWTATZPHSA-N
SMILES_CANONICALCACTVS3.370OC[C@@H](O)C(O)O
SMILESCACTVS3.370OC[CH](O)C(O)O
SMILES_CANONICALOpenEye OEToolkits1.7.2C([C@H](C(O)O)O)O
SMILESOpenEye OEToolkits1.7.2C(C(C(O)O)O)O
171916
PDB entries from 2020-12-02