02N

?

Summary

Name:1-(4-methylphenyl)methanamine
Formula:C8 H11 N
Formal charge:0
Molecular weight:121.18 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.011-(4-methylphenyl)methanamine
OpenEye OEToolkits1.7.2(4-methylphenyl)methanamine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01NCc1ccc(cc1)C
InChIInChI1.03InChI=1S/C8H11N/c1-7-2-4-8(6-9)5-3-7/h2-5H,6,9H2,1H3
InChIKeyInChI1.03HMTSWYPNXFHGEP-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370Cc1ccc(CN)cc1
SMILESCACTVS3.370Cc1ccc(CN)cc1
SMILES_CANONICALOpenEye OEToolkits1.7.2Cc1ccc(cc1)CN
SMILESOpenEye OEToolkits1.7.2Cc1ccc(cc1)CN