00O

?

Summary

Name:beta-phenyl-D-phenylalanine
Formula:C15 H15 N O2
Formal charge:0
Molecular weight:241.285 Da
Component type:D-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs12.01beta-phenyl-D-phenylalanine
OpenEye OEToolkits1.7.0(2R)-2-azanyl-3,3-diphenyl-propanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)C(N)C(c1ccccc1)c2ccccc2
SMILES_CANONICALCACTVS3.370N[C@H](C(c1ccccc1)c2ccccc2)C(O)=O
SMILESCACTVS3.370N[CH](C(c1ccccc1)c2ccccc2)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.0c1ccc(cc1)C(c2ccccc2)[C@H](C(=O)O)N
SMILESOpenEye OEToolkits1.7.0c1ccc(cc1)C(c2ccccc2)C(C(=O)O)N
InChIInChI1.03InChI=1S/C15H15NO2/c16-14(15(17)18)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H,16H2,(H,17,18)/t14-/m1/s1
InChIKeyInChI1.03PECGVEGMRUZOML-CQSZACIVSA-N
168889
PDB entries from 2020-09-16