00M

?

Summary

Name:(2R,3S)-3-amino-2-hydroxy-4-phenylbutanoic acid
Formula:C10 H13 N O3
Formal charge:0
Molecular weight:195.215 Da
Component type:peptide-like

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(2R,3S)-3-amino-2-hydroxy-4-phenylbutanoic acid
OpenEye OEToolkits1.7.0(2R,3S)-3-azanyl-2-hydroxy-4-phenyl-butanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)C(O)C(N)Cc1ccccc1
SMILES_CANONICALCACTVS3.370N[C@@H](Cc1ccccc1)[C@@H](O)C(O)=O
SMILESCACTVS3.370N[CH](Cc1ccccc1)[CH](O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.0c1ccc(cc1)C[C@@H]([C@H](C(=O)O)O)N
SMILESOpenEye OEToolkits1.7.0c1ccc(cc1)CC(C(C(=O)O)O)N
InChIInChI1.03InChI=1S/C10H13NO3/c11-8(9(12)10(13)14)6-7-4-2-1-3-5-7/h1-5,8-9,12H,6,11H2,(H,13,14)/t8-,9+/m0/s1
InChIKeyInChI1.03LDSJMFGYNFIFRK-DTWKUNHWSA-N
169117
PDB entries from 2020-09-23