00G

?

Summary

Name:5-[2-(1H-pyrrol-1-yl)ethoxy]-1H-indole
Formula:C14 H14 N2 O
Formal charge:0
Molecular weight:226.274 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.045-[2-(1H-pyrrol-1-yl)ethoxy]-1H-indole
OpenEye OEToolkits1.5.05-(2-pyrrol-1-ylethoxy)-1H-indole

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O(c1cc2c(cc1)ncc2)CCn3cccc3
SMILES_CANONICALCACTVS3.341C(Cn1cccc1)Oc2ccc3[nH]ccc3c2
SMILESCACTVS3.341C(Cn1cccc1)Oc2ccc3[nH]ccc3c2
SMILES_CANONICALOpenEye OEToolkits1.5.0c1ccn(c1)CCOc2ccc3c(c2)cc[nH]3
SMILESOpenEye OEToolkits1.5.0c1ccn(c1)CCOc2ccc3c(c2)cc[nH]3
InChIInChI1.03InChI=1S/C14H14N2O/c1-2-8-16(7-1)9-10-17-13-3-4-14-12(11-13)5-6-15-14/h1-8,11,15H,9-10H2
InChIKeyInChI1.03NSZDJRLPCLOQAM-UHFFFAOYSA-N
169117
PDB entries from 2020-09-23