00E

?

Summary

Name:morpholin-4-ylacetic acid
Formula:C6 H11 N O3
Formal charge:0
Molecular weight:145.156 Da
Component type:PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs12.01morpholin-4-ylacetic acid
OpenEye OEToolkits1.7.02-morpholin-4-ylethanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)CN1CCOCC1
SMILES_CANONICALCACTVS3.370OC(=O)CN1CCOCC1
SMILESCACTVS3.370OC(=O)CN1CCOCC1
SMILES_CANONICALOpenEye OEToolkits1.7.0C1COCCN1CC(=O)O
SMILESOpenEye OEToolkits1.7.0C1COCCN1CC(=O)O
InChIInChI1.03InChI=1S/C6H11NO3/c8-6(9)5-7-1-3-10-4-2-7/h1-5H2,(H,8,9)
InChIKeyInChI1.03VIWZVFVJPXTXPA-UHFFFAOYSA-N
169117
PDB entries from 2020-09-23