00B

?

Summary

Name:(4R)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid
Formula:C6 H11 N O2 S
Formal charge:0
Molecular weight:161.222 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(4R)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid
OpenEye OEToolkits1.7.0(4R)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)C1NCSC1(C)C
SMILES_CANONICALCACTVS3.370CC1(C)SCN[C@@H]1C(O)=O
SMILESCACTVS3.370CC1(C)SCN[CH]1C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.0CC1([C@H](NCS1)C(=O)O)C
SMILESOpenEye OEToolkits1.7.0CC1(C(NCS1)C(=O)O)C
InChIInChI1.03InChI=1S/C6H11NO2S/c1-6(2)4(5(8)9)7-3-10-6/h4,7H,3H2,1-2H3,(H,8,9)/t4-/m1/s1
InChIKeyInChI1.03PMQQFSDIECYOQV-SCSAIBSYSA-N
169117
PDB entries from 2020-09-23