004

?

Summary

Name:(2S)-amino(phenyl)ethanoic acid
Synonyms:L-Phenylglycine
Formula:C8 H9 N O2
Formal charge:0
Molecular weight:151.163 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(2S)-amino(phenyl)ethanoic acid
OpenEye OEToolkits1.7.0(2S)-2-azanyl-2-phenyl-ethanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)C(N)c1ccccc1
SMILES_CANONICALCACTVS3.370N[C@H](C(O)=O)c1ccccc1
SMILESCACTVS3.370N[CH](C(O)=O)c1ccccc1
SMILES_CANONICALOpenEye OEToolkits1.7.0c1ccc(cc1)[C@@H](C(=O)O)N
SMILESOpenEye OEToolkits1.7.0c1ccc(cc1)C(C(=O)O)N
InChIInChI1.03InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11)/t7-/m0/s1
InChIKeyInChI1.03ZGUNAGUHMKGQNY-ZETCQYMHSA-N
168889
PDB entries from 2020-09-16