000

?

Summary

Name:methyl hydrogen carbonate
Formula:C2 H4 O3
Formal charge:0
Molecular weight:76.051 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01methyl hydrogen carbonate
OpenEye OEToolkits1.7.0methyl hydrogen carbonate

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)OC
SMILES_CANONICALCACTVS3.370COC(O)=O
SMILESCACTVS3.370COC(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.0COC(=O)O
SMILESOpenEye OEToolkits1.7.0COC(=O)O
InChIInChI1.03InChI=1S/C2H4O3/c1-5-2(3)4/h1H3,(H,3,4)
InChIKeyInChI1.03CXHHBNMLPJOKQD-UHFFFAOYSA-N
168889
PDB entries from 2020-09-16