PRD_002335
Summary
Name: | Linear precursor of pseudoxylallemycin A |
Formula: | C32 H46 N4 O5 |
Fomular weight: | 566.731 |
Component type: | peptide-like |
Polymer sequences: | MLE, PHE, MLE, PHE |
Non-polymer components: | |
BIRD class: | Antibiotic |
Represented as: | polymer |
Description: | Mle-Phe-Mle-Phe. Linear precursor of pseudoxylallemycin A. The peptide is linear, unlike Mle-Phe-Mle-Phe Pseudoxylallemycin A that is cyclic. |
Program | Version | Name |
OpenEye OEToolkits | 2.0.7 | (2~{S})-2-[[(2~{S})-4-methyl-2-[methyl-[(2~{S})-2-[[(2~{S})-4-methyl-2-(methylamino)pentanoyl]amino]-3-phenyl-propanoyl]amino]pentanoyl]amino]-3-phenyl-propanoic acid |
Chemical Descriptors
Type | Program | Version | Descriptor |
SMILES_CANONICAL | CACTVS | 3.385 | CN[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](Cc2ccccc2)C(O)=O |
SMILES | CACTVS | 3.385 | CN[CH](CC(C)C)C(=O)N[CH](Cc1ccccc1)C(=O)N(C)[CH](CC(C)C)C(=O)N[CH](Cc2ccccc2)C(O)=O |
SMILES_CANONICAL | OpenEye OEToolkits | 2.0.7 | CC(C)C[C@@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](Cc2ccccc2)C(=O)O)NC |
SMILES | OpenEye OEToolkits | 2.0.7 | CC(C)CC(C(=O)NC(Cc1ccccc1)C(=O)N(C)C(CC(C)C)C(=O)NC(Cc2ccccc2)C(=O)O)NC |