7FX7
 
 | | Crystal Structure of human FABP4 with binding site mutated to FABP5 in complex with 5-methylsulfanyl-2-[(4-phenylmethoxy-1H-indazol-3-yl)methylsulfanyl]pyrimidin-4-ol, i.e. SMILES n1c(c(cnc1SCC1=NNc2c1c(OCc1ccccc1)ccc2)SC)O with IC50=0.372 microM | | Descriptor: | 1,2-ETHANEDIOL, 2-({[4-(benzyloxy)-1H-indazol-3-yl]methyl}sulfanyl)-5-(methylsulfanyl)pyrimidin-4-ol, DIMETHYL SULFOXIDE, ... | | Authors: | Ehler, A, Benz, J, Obst, U, Lubbers, T, Rudolph, M.G. | | Deposit date: | 2023-04-27 | | Release date: | 2023-06-14 | | Last modified: | 2024-11-20 | | Method: | X-RAY DIFFRACTION (1.12 Å) | | Cite: | Crystal Structure of a human FABP4 complex
To be published
|
|
7G38
 | | Crystal Structure of rat Autotaxin in complex with 3-[3-[[(4-bromophenyl)methylamino]methyl]indol-1-yl]-N-methylpropanamide | | Descriptor: | 2-(N-MORPHOLINO)-ETHANESULFONIC ACID, 3-[3-({[(4-bromophenyl)methyl]amino}methyl)-1H-indol-1-yl]-N-methylpropanamide, ACETATE ION, ... | | Authors: | Stihle, M, Benz, J, Hunziker, D, Lubbers, T, Rudolph, M.G. | | Deposit date: | 2023-06-05 | | Release date: | 2024-12-18 | | Method: | X-RAY DIFFRACTION (1.49 Å) | | Cite: | Crystal Structure of a rat Autotaxin complex
To be published
|
|
7G6C
 | | Crystal Structure of rat Autotaxin in complex with 2-[(2-tert-butyl-4-cyano-5-methylphenoxy)methyl]-5-pyrrolidin-1-yl-1,3-oxazole-4-carbonitrile, i.e. SMILES c1c(c(cc(c1C(C)(C)C)OCC1=NC(=C(O1)N1CCCC1)C#N)C)C#N with IC50=0.0607829 microM | | Descriptor: | 2-[(2-tert-butyl-4-cyano-5-methylphenoxy)methyl]-5-(pyrrolidin-1-yl)-1,3-oxazole-4-carbonitrile, CALCIUM ION, CHLORIDE ION, ... | | Authors: | Stihle, M, Benz, J, Hunziker, D, Lubbers, T, Rudolph, M.G. | | Deposit date: | 2023-06-05 | | Release date: | 2024-12-18 | | Method: | X-RAY DIFFRACTION (2.49 Å) | | Cite: | Crystal Structure of a rat Autotaxin complex
To be published
|
|
