7G7R
 
 | | Crystal Structure of rat Autotaxin in complex with 3-[(Z)-1-butan-2-yloxy-2-(2,4-dichlorophenyl)ethenyl]pyridine, i.e. SMILES C(=Cc1c(cc(cc1)Cl)Cl)(/c1cccnc1)O[C@@H](CC)C with IC50=0.375554 microM | | Descriptor: | 3-[(Z)-1-{[(2S)-butan-2-yl]oxy}-2-(2,4-dichlorophenyl)ethenyl]pyridine, ACETATE ION, CALCIUM ION, ... | | Authors: | Stihle, M, Benz, J, Hunziker, D, Pfiffner, A, Rudolph, M.G. | | Deposit date: | 2023-06-05 | | Release date: | 2024-12-18 | | Method: | X-RAY DIFFRACTION (2.01 Å) | | Cite: | Crystal Structure of a rat Autotaxin complex
To be published
|
|
